About [(E)-hexadec-5-enyl] propanoate
[(E)-hexadec-5-enyl] propanoate (PubChem CID 23434883) has the molecular formula C19H36O2
and a molecular weight of 296.50 g/mol. Its IUPAC name is [(E)-hexadec-5-enyl] propanoate.
Molecular Properties
| Compound Name | [(E)-hexadec-5-enyl] propanoate |
| PubChem CID | 23434883 |
| Molecular Formula | C19H36O2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | [(E)-hexadec-5-enyl] propanoate |
| SMILES | CCCCCCCCCC/C=C/CCCCOC(=O)CC |
| InChI | InChI=1S/C19H36O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-19(20)4-2/h13-14H,3-12,15-18H2,1-2H3/b14-13+ |
| InChIKey | YNVYGPDOAWDAGT-BUHFOSPRSA-N |
| XLogP | 6.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-hexadec-5-enyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-hexadec-5-enyl] propanoate?
The IUPAC name of [(E)-hexadec-5-enyl] propanoate (CID 23434883) is [(E)-hexadec-5-enyl] propanoate.
What is the SMILES notation for [(E)-hexadec-5-enyl] propanoate?
The canonical SMILES for [(E)-hexadec-5-enyl] propanoate is CCCCCCCCCC/C=C/CCCCOC(=O)CC.
What is the InChIKey of [(E)-hexadec-5-enyl] propanoate?
The InChIKey is YNVYGPDOAWDAGT-BUHFOSPRSA-N. The full InChI is InChI=1S/C19H36O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-19(20)4-2/h13-14H,3-12,15-18H2,1-2H3/b14-13+.
What are the key properties of [(E)-hexadec-5-enyl] propanoate?
[(E)-hexadec-5-enyl] propanoate has a molecular weight of 296.50 g/mol, XLogP of 6.20, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-hexadec-5-enyl] propanoate is sourced from PubChem (CID 23434883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).