C30H41NO2 — CID 23434908
(2E,4E,6E,8E)-N-(5-tert-butyl-2-hydroxyphenyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide (PubChem CID 23434908) has the molecular formula C30H41NO2 and a molecular weight of 447.66 g/mol. Its IUPAC name is (2E,4E,6E,8E)-N-(5-tert-butyl-2-hydroxyphenyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide.
| Compound Name | (2E,4E,6E,8E)-N-(5-tert-butyl-2-hydroxyphenyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 23434908 |
| Molecular Formula | C30H41NO2 |
| Molecular Weight | 447.66 g/mol |
| Exact Mass | 447.31 |
| IUPAC Name | (2E,4E,6E,8E)-N-(5-tert-butyl-2-hydroxyphenyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)Nc2cc(C(C)(C)C)ccc2O)C(C)(C)CCC1 |
| InChI | InChI=1S/C30H41NO2/c1-21(14-16-25-23(3)13-10-18-30(25,7)8)11-9-12-22(2)19-28(33)31-26-20-24(29(4,5)6)15-17-27(26)32/h9,11-12,14-17,19-20,32H,10,13,18H2,1-8H3,(H,31,33)/b12-9+,16-14+,21-11+,22-19+ |
| InChIKey | LDZNJTLALJFCAE-KQKSCMBMSA-N |
| XLogP | 8.16 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.66 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|