About 1,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile
1,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile (PubChem CID 23435291) has the molecular formula C7H7NO2
and a molecular weight of 137.14 g/mol. Its IUPAC name is 1,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 1,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile |
| PubChem CID | 23435291 |
| Molecular Formula | C7H7NO2 |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.05 |
| IUPAC Name | 1,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile |
| SMILES | N#CC1(O)C=CC=CC1O |
| InChI | InChI=1S/C7H7NO2/c8-5-7(10)4-2-1-3-6(7)9/h1-4,6,9-10H |
| InChIKey | PCQOGPFBEBXPFE-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|
Analyze 1,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile?
The IUPAC name of 1,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile (CID 23435291) is 1,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile.
What is the SMILES notation for 1,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile?
The canonical SMILES for 1,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile is N#CC1(O)C=CC=CC1O.
What is the InChIKey of 1,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile?
The InChIKey is PCQOGPFBEBXPFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2/c8-5-7(10)4-2-1-3-6(7)9/h1-4,6,9-10H.
What are the key properties of 1,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile?
1,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile has a molecular weight of 137.14 g/mol, XLogP of -0.27, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile is sourced from PubChem (CID 23435291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).