C14H17Cl2N3O — CID 23436585
2-[3-(2,4-dichlorophenyl)-1,2,4-triazol-1-yl]hexan-2-ol (PubChem CID 23436585) has the molecular formula C14H17Cl2N3O and a molecular weight of 314.22 g/mol. Its IUPAC name is 2-[3-(2,4-dichlorophenyl)-1,2,4-triazol-1-yl]hexan-2-ol.
| Compound Name | 2-[3-(2,4-dichlorophenyl)-1,2,4-triazol-1-yl]hexan-2-ol |
|---|---|
| PubChem CID | 23436585 |
| Molecular Formula | C14H17Cl2N3O |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-[3-(2,4-dichlorophenyl)-1,2,4-triazol-1-yl]hexan-2-ol |
| SMILES | CCCCC(C)(O)n1cnc(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C14H17Cl2N3O/c1-3-4-7-14(2,20)19-9-17-13(18-19)11-6-5-10(15)8-12(11)16/h5-6,8-9,20H,3-4,7H2,1-2H3 |
| InChIKey | CISDWKCFCOHFDW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |