C11H18N4O6 — CID 23436594
2,6-diaminohexanoic acid;2,4-dioxo-1H-pyrimidine-6-carboxylic acid (PubChem CID 23436594) has the molecular formula C11H18N4O6 and a molecular weight of 302.29 g/mol. Its IUPAC name is 2,6-diaminohexanoic acid;2,4-dioxo-1H-pyrimidine-6-carboxylic acid.
| Compound Name | 2,6-diaminohexanoic acid;2,4-dioxo-1H-pyrimidine-6-carboxylic acid |
|---|---|
| PubChem CID | 23436594 |
| Molecular Formula | C11H18N4O6 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2,6-diaminohexanoic acid;2,4-dioxo-1H-pyrimidine-6-carboxylic acid |
| SMILES | NCCCCC(N)C(=O)O.O=C(O)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C6H14N2O2.C5H4N2O4/c7-4-2-1-3-5(8)6(9)10;8-3-1-2(4(9)10)6-5(11)7-3/h5H,1-4,7-8H2,(H,9,10);1H,(H,9,10)(H2,6,7,8,11) |
| InChIKey | FVGJURXBWORGKL-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 192.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|