C18H26N2 — CID 23436662
2,3,3a,4,5,6-hexahydro-1H-inden-4-yl(2,3,5,6,7,7a-hexahydro-1H-inden-4-yl)diazene (PubChem CID 23436662) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 2,3,3a,4,5,6-hexahydro-1H-inden-4-yl(2,3,5,6,7,7a-hexahydro-1H-inden-4-yl)diazene.
| Compound Name | 2,3,3a,4,5,6-hexahydro-1H-inden-4-yl(2,3,5,6,7,7a-hexahydro-1H-inden-4-yl)diazene |
|---|---|
| PubChem CID | 23436662 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 2,3,3a,4,5,6-hexahydro-1H-inden-4-yl(2,3,5,6,7,7a-hexahydro-1H-inden-4-yl)diazene |
| SMILES | C1=C2CCCC2C(/N=N/C2=C3CCCC3CCC2)CC1 |
| InChI | InChI=1S/C18H26N2/c1-5-13-7-3-11-17(15(13)9-1)19-20-18-12-4-8-14-6-2-10-16(14)18/h7,14-15,17H,1-6,8-12H2/b20-19+ |
| InChIKey | NITNILMLDIDCPF-FMQUCBEESA-N |
| XLogP | 5.57 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|