C18H26FNO — CID 23437083
4,4-diethyl-2-[2-fluoro-4-[(E)-pent-3-enyl]phenyl]-1,3-oxazolidine (PubChem CID 23437083) has the molecular formula C18H26FNO and a molecular weight of 291.41 g/mol. Its IUPAC name is 4,4-diethyl-2-[2-fluoro-4-[(E)-pent-3-enyl]phenyl]-1,3-oxazolidine.
| Compound Name | 4,4-diethyl-2-[2-fluoro-4-[(E)-pent-3-enyl]phenyl]-1,3-oxazolidine |
|---|---|
| PubChem CID | 23437083 |
| Molecular Formula | C18H26FNO |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 4,4-diethyl-2-[2-fluoro-4-[(E)-pent-3-enyl]phenyl]-1,3-oxazolidine |
| SMILES | C/C=C/CCc1ccc(C2NC(CC)(CC)CO2)c(F)c1 |
| InChI | InChI=1S/C18H26FNO/c1-4-7-8-9-14-10-11-15(16(19)12-14)17-20-18(5-2,6-3)13-21-17/h4,7,10-12,17,20H,5-6,8-9,13H2,1-3H3/b7-4+ |
| InChIKey | VKTNKEHWSQZLQN-QPJJXVBHSA-N |
| XLogP | 4.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|