C20H21Cl2N5O6S — CID 23437656
3-(3,5-dichloro-2-hydroxyphenyl)-3-[[2-[[4-[(5-hydroxy-1,4,5,6-tetrahydropyrimidin-2-yl)amino]thiophene-2-carbonyl]amino]acetyl]amino]propanoic acid (PubChem CID 23437656) has the molecular formula C20H21Cl2N5O6S and a molecular weight of 530.39 g/mol. Its IUPAC name is 3-(3,5-dichloro-2-hydroxyphenyl)-3-[[2-[[4-[(5-hydroxy-1,4,5,6-tetrahydropyrimidin-2-yl)amino]thiophene-2-carbonyl]amino]acetyl]amino]propanoic acid.
| Compound Name | 3-(3,5-dichloro-2-hydroxyphenyl)-3-[[2-[[4-[(5-hydroxy-1,4,5,6-tetrahydropyrimidin-2-yl)amino]thiophene-2-carbonyl]amino]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 23437656 |
| Molecular Formula | C20H21Cl2N5O6S |
| Molecular Weight | 530.39 g/mol |
| Exact Mass | 529.06 |
| IUPAC Name | 3-(3,5-dichloro-2-hydroxyphenyl)-3-[[2-[[4-[(5-hydroxy-1,4,5,6-tetrahydropyrimidin-2-yl)amino]thiophene-2-carbonyl]amino]acetyl]amino]propanoic acid |
| SMILES | O=C(O)CC(NC(=O)CNC(=O)c1cc(NC2=NCC(O)CN2)cs1)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C20H21Cl2N5O6S/c21-9-1-12(18(32)13(22)2-9)14(4-17(30)31)27-16(29)7-23-19(33)15-3-10(8-34-15)26-20-24-5-11(28)6-25-20/h1-3,8,11,14,28,32H,4-7H2,(H,23,33)(H,27,29)(H,30,31)(H2,24,25,26) |
| InChIKey | PZXJSDSRVZTVEN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 172.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|