About 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]propanoic acid
2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]propanoic acid (PubChem CID 23437679) has the molecular formula C7H10N4O2S
and a molecular weight of 214.25 g/mol. Its IUPAC name is 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]propanoic acid.
Molecular Properties
| Compound Name | 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]propanoic acid |
| PubChem CID | 23437679 |
| Molecular Formula | C7H10N4O2S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]propanoic acid |
| SMILES | CC(C(=O)O)c1csc(N=C(N)N)n1 |
| InChI | InChI=1S/C7H10N4O2S/c1-3(5(12)13)4-2-14-7(10-4)11-6(8)9/h2-3H,1H3,(H,12,13)(H4,8,9,10,11) |
| InChIKey | XLXMXCLRWSOTCD-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]propanoic acid?
The IUPAC name of 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]propanoic acid (CID 23437679) is 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]propanoic acid.
What is the SMILES notation for 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]propanoic acid?
The canonical SMILES for 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]propanoic acid is CC(C(=O)O)c1csc(N=C(N)N)n1.
What is the InChIKey of 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]propanoic acid?
The InChIKey is XLXMXCLRWSOTCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O2S/c1-3(5(12)13)4-2-14-7(10-4)11-6(8)9/h2-3H,1H3,(H,12,13)(H4,8,9,10,11).
What are the key properties of 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]propanoic acid?
2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]propanoic acid has a molecular weight of 214.25 g/mol, XLogP of 0.24, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]propanoic acid is sourced from PubChem (CID 23437679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).