C33H33N5O2S — CID 23437936
4-[4-(furan-3-ylmethyl)anilino]-7-[5-[(3-morpholin-4-ylpropylamino)methyl]thiophen-3-yl]quinoline-3-carbonitrile (PubChem CID 23437936) has the molecular formula C33H33N5O2S and a molecular weight of 563.73 g/mol. Its IUPAC name is 4-[4-(furan-3-ylmethyl)anilino]-7-[5-[(3-morpholin-4-ylpropylamino)methyl]thiophen-3-yl]quinoline-3-carbonitrile.
| Compound Name | 4-[4-(furan-3-ylmethyl)anilino]-7-[5-[(3-morpholin-4-ylpropylamino)methyl]thiophen-3-yl]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 23437936 |
| Molecular Formula | C33H33N5O2S |
| Molecular Weight | 563.73 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | 4-[4-(furan-3-ylmethyl)anilino]-7-[5-[(3-morpholin-4-ylpropylamino)methyl]thiophen-3-yl]quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2cc(-c3csc(CNCCCN4CCOCC4)c3)ccc2c1Nc1ccc(Cc2ccoc2)cc1 |
| InChI | InChI=1S/C33H33N5O2S/c34-19-28-20-36-32-18-26(27-17-30(41-23-27)21-35-9-1-10-38-11-14-39-15-12-38)4-7-31(32)33(28)37-29-5-2-24(3-6-29)16-25-8-13-40-22-25/h2-8,13,17-18,20,22-23,35H,1,9-12,14-16,21H2,(H,36,37) |
| InChIKey | QXDNTBHNMNRSOM-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.73 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|