C29H23ClN4O2S — CID 23438327
4-(3-chloro-4-phenylsulfanylanilino)-7-[5-[(2-hydroxyethylamino)methyl]furan-2-yl]quinoline-3-carbonitrile (PubChem CID 23438327) has the molecular formula C29H23ClN4O2S and a molecular weight of 527.05 g/mol. Its IUPAC name is 4-(3-chloro-4-phenylsulfanylanilino)-7-[5-[(2-hydroxyethylamino)methyl]furan-2-yl]quinoline-3-carbonitrile.
| Compound Name | 4-(3-chloro-4-phenylsulfanylanilino)-7-[5-[(2-hydroxyethylamino)methyl]furan-2-yl]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 23438327 |
| Molecular Formula | C29H23ClN4O2S |
| Molecular Weight | 527.05 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | 4-(3-chloro-4-phenylsulfanylanilino)-7-[5-[(2-hydroxyethylamino)methyl]furan-2-yl]quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2cc(-c3ccc(CNCCO)o3)ccc2c1Nc1ccc(Sc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C29H23ClN4O2S/c30-25-15-21(7-11-28(25)37-23-4-2-1-3-5-23)34-29-20(16-31)17-33-26-14-19(6-9-24(26)29)27-10-8-22(36-27)18-32-12-13-35/h1-11,14-15,17,32,35H,12-13,18H2,(H,33,34) |
| InChIKey | RHENNQSMFCNVAC-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.05 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|