About 5-bromo-2-(2,5-dihydropyrrol-1-yl)pyridine
5-bromo-2-(2,5-dihydropyrrol-1-yl)pyridine (PubChem CID 23438624) has the molecular formula C9H9BrN2
and a molecular weight of 225.09 g/mol. Its IUPAC name is 5-bromo-2-(2,5-dihydropyrrol-1-yl)pyridine.
Molecular Properties
| Compound Name | 5-bromo-2-(2,5-dihydropyrrol-1-yl)pyridine |
| PubChem CID | 23438624 |
| Molecular Formula | C9H9BrN2 |
| Molecular Weight | 225.09 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | 5-bromo-2-(2,5-dihydropyrrol-1-yl)pyridine |
| SMILES | Brc1ccc(N2CC=CC2)nc1 |
| InChI | InChI=1S/C9H9BrN2/c10-8-3-4-9(11-7-8)12-5-1-2-6-12/h1-4,7H,5-6H2 |
| InChIKey | VXJRNDQLKAACRY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.09 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-(2,5-dihydropyrrol-1-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(2,5-dihydropyrrol-1-yl)pyridine?
The IUPAC name of 5-bromo-2-(2,5-dihydropyrrol-1-yl)pyridine (CID 23438624) is 5-bromo-2-(2,5-dihydropyrrol-1-yl)pyridine.
What is the SMILES notation for 5-bromo-2-(2,5-dihydropyrrol-1-yl)pyridine?
The canonical SMILES for 5-bromo-2-(2,5-dihydropyrrol-1-yl)pyridine is Brc1ccc(N2CC=CC2)nc1.
What is the InChIKey of 5-bromo-2-(2,5-dihydropyrrol-1-yl)pyridine?
The InChIKey is VXJRNDQLKAACRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN2/c10-8-3-4-9(11-7-8)12-5-1-2-6-12/h1-4,7H,5-6H2.
What are the key properties of 5-bromo-2-(2,5-dihydropyrrol-1-yl)pyridine?
5-bromo-2-(2,5-dihydropyrrol-1-yl)pyridine has a molecular weight of 225.09 g/mol, XLogP of 2.22, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(2,5-dihydropyrrol-1-yl)pyridine is sourced from PubChem (CID 23438624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).