C30H31NO8 — CID 23438919
dimethyl 2,6-dimethyl-4-[2-[4-(2-oxochromen-3-yl)oxybutoxy]phenyl]-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 23438919) has the molecular formula C30H31NO8 and a molecular weight of 533.58 g/mol. Its IUPAC name is dimethyl 2,6-dimethyl-4-[2-[4-(2-oxochromen-3-yl)oxybutoxy]phenyl]-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 2,6-dimethyl-4-[2-[4-(2-oxochromen-3-yl)oxybutoxy]phenyl]-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 23438919 |
| Molecular Formula | C30H31NO8 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | dimethyl 2,6-dimethyl-4-[2-[4-(2-oxochromen-3-yl)oxybutoxy]phenyl]-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1ccccc1OCCCCOc1cc2ccccc2oc1=O |
| InChI | InChI=1S/C30H31NO8/c1-18-25(29(33)35-3)27(26(19(2)31-18)30(34)36-4)21-12-6-8-14-23(21)37-15-9-10-16-38-24-17-20-11-5-7-13-22(20)39-28(24)32/h5-8,11-14,17,27,31H,9-10,15-16H2,1-4H3 |
| InChIKey | XXKLYUMDYAHIDF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|