About 2-[3-amino-4-(2,4-dioxopyrimidin-1-yl)cyclohexyl]acetic acid
2-[3-amino-4-(2,4-dioxopyrimidin-1-yl)cyclohexyl]acetic acid (PubChem CID 23439292) has the molecular formula C12H17N3O4
and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-[3-amino-4-(2,4-dioxopyrimidin-1-yl)cyclohexyl]acetic acid.
Molecular Properties
| Compound Name | 2-[3-amino-4-(2,4-dioxopyrimidin-1-yl)cyclohexyl]acetic acid |
| PubChem CID | 23439292 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 2-[3-amino-4-(2,4-dioxopyrimidin-1-yl)cyclohexyl]acetic acid |
| SMILES | NC1CC(CC(=O)O)CCC1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C12H17N3O4/c13-8-5-7(6-11(17)18)1-2-9(8)15-4-3-10(16)14-12(15)19/h3-4,7-9H,1-2,5-6,13H2,(H,17,18)(H,14,16,19) |
| InChIKey | HZKXHKASZBPHBZ-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 118.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-amino-4-(2,4-dioxopyrimidin-1-yl)cyclohexyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-amino-4-(2,4-dioxopyrimidin-1-yl)cyclohexyl]acetic acid?
The IUPAC name of 2-[3-amino-4-(2,4-dioxopyrimidin-1-yl)cyclohexyl]acetic acid (CID 23439292) is 2-[3-amino-4-(2,4-dioxopyrimidin-1-yl)cyclohexyl]acetic acid.
What is the SMILES notation for 2-[3-amino-4-(2,4-dioxopyrimidin-1-yl)cyclohexyl]acetic acid?
The canonical SMILES for 2-[3-amino-4-(2,4-dioxopyrimidin-1-yl)cyclohexyl]acetic acid is NC1CC(CC(=O)O)CCC1n1ccc(=O)[nH]c1=O.
What is the InChIKey of 2-[3-amino-4-(2,4-dioxopyrimidin-1-yl)cyclohexyl]acetic acid?
The InChIKey is HZKXHKASZBPHBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O4/c13-8-5-7(6-11(17)18)1-2-9(8)15-4-3-10(16)14-12(15)19/h3-4,7-9H,1-2,5-6,13H2,(H,17,18)(H,14,16,19).
What are the key properties of 2-[3-amino-4-(2,4-dioxopyrimidin-1-yl)cyclohexyl]acetic acid?
2-[3-amino-4-(2,4-dioxopyrimidin-1-yl)cyclohexyl]acetic acid has a molecular weight of 267.28 g/mol, XLogP of -0.32, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-amino-4-(2,4-dioxopyrimidin-1-yl)cyclohexyl]acetic acid is sourced from PubChem (CID 23439292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).