C11H7ClF4N2O2S — CID 23439469
[2-chloro-3-fluoro-4-[(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)amino]phenyl] thiocyanate (PubChem CID 23439469) has the molecular formula C11H7ClF4N2O2S and a molecular weight of 342.70 g/mol. Its IUPAC name is [2-chloro-3-fluoro-4-[(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)amino]phenyl] thiocyanate.
| Compound Name | [2-chloro-3-fluoro-4-[(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 23439469 |
| Molecular Formula | C11H7ClF4N2O2S |
| Molecular Weight | 342.70 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | [2-chloro-3-fluoro-4-[(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)amino]phenyl] thiocyanate |
| SMILES | CC(O)(C(=O)Nc1ccc(SC#N)c(Cl)c1F)C(F)(F)F |
| InChI | InChI=1S/C11H7ClF4N2O2S/c1-10(20,11(14,15)16)9(19)18-5-2-3-6(21-4-17)7(12)8(5)13/h2-3,20H,1H3,(H,18,19) |
| InChIKey | WOUXQJBSTHPZDJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.70 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|