About 7-iodo-2,2-dimethyl-4H-1,3-benzodioxine
7-iodo-2,2-dimethyl-4H-1,3-benzodioxine (PubChem CID 23439888) has the molecular formula C10H11IO2
and a molecular weight of 290.10 g/mol. Its IUPAC name is 7-iodo-2,2-dimethyl-4H-1,3-benzodioxine.
Molecular Properties
| Compound Name | 7-iodo-2,2-dimethyl-4H-1,3-benzodioxine |
| PubChem CID | 23439888 |
| Molecular Formula | C10H11IO2 |
| Molecular Weight | 290.10 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | 7-iodo-2,2-dimethyl-4H-1,3-benzodioxine |
| SMILES | CC1(C)OCc2ccc(I)cc2O1 |
| InChI | InChI=1S/C10H11IO2/c1-10(2)12-6-7-3-4-8(11)5-9(7)13-10/h3-5H,6H2,1-2H3 |
| InChIKey | FPKPINPNIQDFRP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.10 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-iodo-2,2-dimethyl-4H-1,3-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iodo-2,2-dimethyl-4H-1,3-benzodioxine?
The IUPAC name of 7-iodo-2,2-dimethyl-4H-1,3-benzodioxine (CID 23439888) is 7-iodo-2,2-dimethyl-4H-1,3-benzodioxine.
What is the SMILES notation for 7-iodo-2,2-dimethyl-4H-1,3-benzodioxine?
The canonical SMILES for 7-iodo-2,2-dimethyl-4H-1,3-benzodioxine is CC1(C)OCc2ccc(I)cc2O1.
What is the InChIKey of 7-iodo-2,2-dimethyl-4H-1,3-benzodioxine?
The InChIKey is FPKPINPNIQDFRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11IO2/c1-10(2)12-6-7-3-4-8(11)5-9(7)13-10/h3-5H,6H2,1-2H3.
What are the key properties of 7-iodo-2,2-dimethyl-4H-1,3-benzodioxine?
7-iodo-2,2-dimethyl-4H-1,3-benzodioxine has a molecular weight of 290.10 g/mol, XLogP of 2.94, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iodo-2,2-dimethyl-4H-1,3-benzodioxine is sourced from PubChem (CID 23439888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).