C13H9F17 — CID 23440027
1,1,1,4-tetrafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,4-bis(trifluoromethyl)oct-2-ene (PubChem CID 23440027) has the molecular formula C13H9F17 and a molecular weight of 488.18 g/mol. Its IUPAC name is 1,1,1,4-tetrafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,4-bis(trifluoromethyl)oct-2-ene.
| Compound Name | 1,1,1,4-tetrafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,4-bis(trifluoromethyl)oct-2-ene |
|---|---|
| PubChem CID | 23440027 |
| Molecular Formula | C13H9F17 |
| Molecular Weight | 488.18 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | 1,1,1,4-tetrafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,4-bis(trifluoromethyl)oct-2-ene |
| SMILES | CCCCC(F)(C(=C(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H9F17/c1-2-3-4-7(14,11(22,23)24)5(6(9(16,17)18)10(19,20)21)8(15,12(25,26)27)13(28,29)30/h2-4H2,1H3 |
| InChIKey | NWLTUTXABMUKGL-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.18 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|