C18H26N4O2 — CID 23440224
3-[3,6-diamino-2-[[4-(dimethylamino)anilino]methyl]phenyl]propane-1,1-diol (PubChem CID 23440224) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 3-[3,6-diamino-2-[[4-(dimethylamino)anilino]methyl]phenyl]propane-1,1-diol.
| Compound Name | 3-[3,6-diamino-2-[[4-(dimethylamino)anilino]methyl]phenyl]propane-1,1-diol |
|---|---|
| PubChem CID | 23440224 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 3-[3,6-diamino-2-[[4-(dimethylamino)anilino]methyl]phenyl]propane-1,1-diol |
| SMILES | CN(C)c1ccc(NCc2c(N)ccc(N)c2CCC(O)O)cc1 |
| InChI | InChI=1S/C18H26N4O2/c1-22(2)13-5-3-12(4-6-13)21-11-15-14(7-10-18(23)24)16(19)8-9-17(15)20/h3-6,8-9,18,21,23-24H,7,10-11,19-20H2,1-2H3 |
| InChIKey | VMZFDBCGIOBFEQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|