C22H20F3NO3S — CID 2344132
ethyl (4R,4aR)-3-methyl-5-oxo-4-[4-(trifluoromethyl)phenyl]-4a,6,7,9-tetrahydro-4H-thieno[2,3-b]quinoline-2-carboxylate (PubChem CID 2344132) has the molecular formula C22H20F3NO3S and a molecular weight of 435.47 g/mol. Its IUPAC name is ethyl (4R,4aR)-3-methyl-5-oxo-4-[4-(trifluoromethyl)phenyl]-4a,6,7,9-tetrahydro-4H-thieno[2,3-b]quinoline-2-carboxylate.
| Compound Name | ethyl (4R,4aR)-3-methyl-5-oxo-4-[4-(trifluoromethyl)phenyl]-4a,6,7,9-tetrahydro-4H-thieno[2,3-b]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 2344132 |
| Molecular Formula | C22H20F3NO3S |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | ethyl (4R,4aR)-3-methyl-5-oxo-4-[4-(trifluoromethyl)phenyl]-4a,6,7,9-tetrahydro-4H-thieno[2,3-b]quinoline-2-carboxylate |
| SMILES | CCOC(=O)c1sc2c(c1C)[C@@H](c1ccc(C(F)(F)F)cc1)[C@H]1C(=O)CCC=C1N2 |
| InChI | InChI=1S/C22H20F3NO3S/c1-3-29-21(28)19-11(2)16-17(12-7-9-13(10-8-12)22(23,24)25)18-14(26-20(16)30-19)5-4-6-15(18)27/h5,7-10,17-18,26H,3-4,6H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | LJTZZDMJVRLZOM-QZTJIDSGSA-N |
| XLogP | 5.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |