About tert-butyl 1-[2,6-difluoro-4-(phenylmethoxycarbonylamino)phenyl]cyclopropane-1-carboxylate
tert-butyl 1-[2,6-difluoro-4-(phenylmethoxycarbonylamino)phenyl]cyclopropane-1-carboxylate (PubChem CID 23441495) has the molecular formula C22H23F2NO4
and a molecular weight of 403.43 g/mol. Its IUPAC name is tert-butyl 1-[2,6-difluoro-4-(phenylmethoxycarbonylamino)phenyl]cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 1-[2,6-difluoro-4-(phenylmethoxycarbonylamino)phenyl]cyclopropane-1-carboxylate |
| PubChem CID | 23441495 |
| Molecular Formula | C22H23F2NO4 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | tert-butyl 1-[2,6-difluoro-4-(phenylmethoxycarbonylamino)phenyl]cyclopropane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(c2c(F)cc(NC(=O)OCc3ccccc3)cc2F)CC1 |
| InChI | InChI=1S/C22H23F2NO4/c1-21(2,3)29-19(26)22(9-10-22)18-16(23)11-15(12-17(18)24)25-20(27)28-13-14-7-5-4-6-8-14/h4-8,11-12H,9-10,13H2,1-3H3,(H,25,27) |
| InChIKey | ONGVIZXVZVDUAY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 1-[2,6-difluoro-4-(phenylmethoxycarbonylamino)phenyl]cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 1-[2,6-difluoro-4-(phenylmethoxycarbonylamino)phenyl]cyclopropane-1-carboxylate?
The IUPAC name of tert-butyl 1-[2,6-difluoro-4-(phenylmethoxycarbonylamino)phenyl]cyclopropane-1-carboxylate (CID 23441495) is tert-butyl 1-[2,6-difluoro-4-(phenylmethoxycarbonylamino)phenyl]cyclopropane-1-carboxylate.
What is the SMILES notation for tert-butyl 1-[2,6-difluoro-4-(phenylmethoxycarbonylamino)phenyl]cyclopropane-1-carboxylate?
The canonical SMILES for tert-butyl 1-[2,6-difluoro-4-(phenylmethoxycarbonylamino)phenyl]cyclopropane-1-carboxylate is CC(C)(C)OC(=O)C1(c2c(F)cc(NC(=O)OCc3ccccc3)cc2F)CC1.
What is the InChIKey of tert-butyl 1-[2,6-difluoro-4-(phenylmethoxycarbonylamino)phenyl]cyclopropane-1-carboxylate?
The InChIKey is ONGVIZXVZVDUAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23F2NO4/c1-21(2,3)29-19(26)22(9-10-22)18-16(23)11-15(12-17(18)24)25-20(27)28-13-14-7-5-4-6-8-14/h4-8,11-12H,9-10,13H2,1-3H3,(H,25,27).
What are the key properties of tert-butyl 1-[2,6-difluoro-4-(phenylmethoxycarbonylamino)phenyl]cyclopropane-1-carboxylate?
tert-butyl 1-[2,6-difluoro-4-(phenylmethoxycarbonylamino)phenyl]cyclopropane-1-carboxylate has a molecular weight of 403.43 g/mol, XLogP of 5.09, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 1-[2,6-difluoro-4-(phenylmethoxycarbonylamino)phenyl]cyclopropane-1-carboxylate is sourced from PubChem (CID 23441495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).