About 1-methyl-4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazine
1-methyl-4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazine (PubChem CID 23441906) has the molecular formula C10H11F4N3
and a molecular weight of 249.21 g/mol. Its IUPAC name is 1-methyl-4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazine.
Molecular Properties
| Compound Name | 1-methyl-4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazine |
| PubChem CID | 23441906 |
| Molecular Formula | C10H11F4N3 |
| Molecular Weight | 249.21 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 1-methyl-4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazine |
| SMILES | CN1CCN(c2c(F)c(F)nc(F)c2F)CC1 |
| InChI | InChI=1S/C10H11F4N3/c1-16-2-4-17(5-3-16)8-6(11)9(13)15-10(14)7(8)12/h2-5H2,1H3 |
| InChIKey | ZIMFHRBBMKIZJJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazine?
The IUPAC name of 1-methyl-4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazine (CID 23441906) is 1-methyl-4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazine.
What is the SMILES notation for 1-methyl-4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazine?
The canonical SMILES for 1-methyl-4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazine is CN1CCN(c2c(F)c(F)nc(F)c2F)CC1.
What is the InChIKey of 1-methyl-4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazine?
The InChIKey is ZIMFHRBBMKIZJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F4N3/c1-16-2-4-17(5-3-16)8-6(11)9(13)15-10(14)7(8)12/h2-5H2,1H3.
What are the key properties of 1-methyl-4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazine?
1-methyl-4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazine has a molecular weight of 249.21 g/mol, XLogP of 1.39, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazine is sourced from PubChem (CID 23441906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).