C20H21NO3 — CID 23442
6-methoxy-3,3,12-trimethyl-7H-pyrano[2,3-c]acridin-7-ol (PubChem CID 23442) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 6-methoxy-3,3,12-trimethyl-7H-pyrano[2,3-c]acridin-7-ol.
| Compound Name | 6-methoxy-3,3,12-trimethyl-7H-pyrano[2,3-c]acridin-7-ol |
|---|---|
| PubChem CID | 23442 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 6-methoxy-3,3,12-trimethyl-7H-pyrano[2,3-c]acridin-7-ol |
| SMILES | COc1cc2c(c3c1C(O)c1ccccc1N3C)C=CC(C)(C)O2 |
| InChI | InChI=1S/C20H21NO3/c1-20(2)10-9-13-15(24-20)11-16(23-4)17-18(13)21(3)14-8-6-5-7-12(14)19(17)22/h5-11,19,22H,1-4H3 |
| InChIKey | PFNSTWXXJBWAIV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |