C28H25F3N2O7 — CID 23442205
4-phenylmethoxy-3-[[3,5,6-trifluoro-4-[(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)methoxy]-2-pyridinyl]oxy]benzonitrile (PubChem CID 23442205) has the molecular formula C28H25F3N2O7 and a molecular weight of 558.51 g/mol. Its IUPAC name is 4-phenylmethoxy-3-[[3,5,6-trifluoro-4-[(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)methoxy]-2-pyridinyl]oxy]benzonitrile.
| Compound Name | 4-phenylmethoxy-3-[[3,5,6-trifluoro-4-[(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)methoxy]-2-pyridinyl]oxy]benzonitrile |
|---|---|
| PubChem CID | 23442205 |
| Molecular Formula | C28H25F3N2O7 |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | 4-phenylmethoxy-3-[[3,5,6-trifluoro-4-[(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)methoxy]-2-pyridinyl]oxy]benzonitrile |
| SMILES | COC1OC(COc2c(F)c(F)nc(Oc3cc(C#N)ccc3OCc3ccccc3)c2F)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C28H25F3N2O7/c1-28(2)39-22-19(38-27(34-3)24(22)40-28)14-36-23-20(29)25(31)33-26(21(23)30)37-18-11-16(12-32)9-10-17(18)35-13-15-7-5-4-6-8-15/h4-11,19,22,24,27H,13-14H2,1-3H3 |
| InChIKey | ZTSAPUIFZDYZLQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 101.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|