C18H26O3 — CID 23442893
(6-tert-butyl-2-methyl-2,3-dihydro-1-benzofuran-5-yl) 2,2-dimethylpropanoate (PubChem CID 23442893) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (6-tert-butyl-2-methyl-2,3-dihydro-1-benzofuran-5-yl) 2,2-dimethylpropanoate.
| Compound Name | (6-tert-butyl-2-methyl-2,3-dihydro-1-benzofuran-5-yl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 23442893 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (6-tert-butyl-2-methyl-2,3-dihydro-1-benzofuran-5-yl) 2,2-dimethylpropanoate |
| SMILES | CC1Cc2cc(OC(=O)C(C)(C)C)c(C(C)(C)C)cc2O1 |
| InChI | InChI=1S/C18H26O3/c1-11-8-12-9-15(21-16(19)18(5,6)7)13(17(2,3)4)10-14(12)20-11/h9-11H,8H2,1-7H3 |
| InChIKey | QJGFQBOJQPREIA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|