About 2-(1-hydroxyethyl)cyclodecan-1-ol;4-methylcyclohexan-1-ol
2-(1-hydroxyethyl)cyclodecan-1-ol;4-methylcyclohexan-1-ol (PubChem CID 23443107) has the molecular formula C19H38O3
and a molecular weight of 314.51 g/mol. Its IUPAC name is 2-(1-hydroxyethyl)cyclodecan-1-ol;4-methylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 2-(1-hydroxyethyl)cyclodecan-1-ol;4-methylcyclohexan-1-ol |
| PubChem CID | 23443107 |
| Molecular Formula | C19H38O3 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.28 |
| IUPAC Name | 2-(1-hydroxyethyl)cyclodecan-1-ol;4-methylcyclohexan-1-ol |
| SMILES | CC(O)C1CCCCCCCCC1O.CC1CCC(O)CC1 |
| InChI | InChI=1S/C12H24O2.C7H14O/c1-10(13)11-8-6-4-2-3-5-7-9-12(11)14;1-6-2-4-7(8)5-3-6/h10-14H,2-9H2,1H3;6-8H,2-5H2,1H3 |
| InChIKey | YOSDWPWNBSBFQF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1-hydroxyethyl)cyclodecan-1-ol;4-methylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-hydroxyethyl)cyclodecan-1-ol;4-methylcyclohexan-1-ol?
The IUPAC name of 2-(1-hydroxyethyl)cyclodecan-1-ol;4-methylcyclohexan-1-ol (CID 23443107) is 2-(1-hydroxyethyl)cyclodecan-1-ol;4-methylcyclohexan-1-ol.
What is the SMILES notation for 2-(1-hydroxyethyl)cyclodecan-1-ol;4-methylcyclohexan-1-ol?
The canonical SMILES for 2-(1-hydroxyethyl)cyclodecan-1-ol;4-methylcyclohexan-1-ol is CC(O)C1CCCCCCCCC1O.CC1CCC(O)CC1.
What is the InChIKey of 2-(1-hydroxyethyl)cyclodecan-1-ol;4-methylcyclohexan-1-ol?
The InChIKey is YOSDWPWNBSBFQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2.C7H14O/c1-10(13)11-8-6-4-2-3-5-7-9-12(11)14;1-6-2-4-7(8)5-3-6/h10-14H,2-9H2,1H3;6-8H,2-5H2,1H3.
What are the key properties of 2-(1-hydroxyethyl)cyclodecan-1-ol;4-methylcyclohexan-1-ol?
2-(1-hydroxyethyl)cyclodecan-1-ol;4-methylcyclohexan-1-ol has a molecular weight of 314.51 g/mol, XLogP of 4.04, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hydroxyethyl)cyclodecan-1-ol;4-methylcyclohexan-1-ol is sourced from PubChem (CID 23443107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).