C20H12N2OS — CID 2344321
2-[2-(furan-2-yl)quinolin-4-yl]-1,3-benzothiazole (PubChem CID 2344321) has the molecular formula C20H12N2OS and a molecular weight of 328.40 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)quinolin-4-yl]-1,3-benzothiazole.
| Compound Name | 2-[2-(furan-2-yl)quinolin-4-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 2344321 |
| Molecular Formula | C20H12N2OS |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 2-[2-(furan-2-yl)quinolin-4-yl]-1,3-benzothiazole |
| SMILES | c1coc(-c2cc(-c3nc4ccccc4s3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C20H12N2OS/c1-2-7-15-13(6-1)14(12-17(21-15)18-9-5-11-23-18)20-22-16-8-3-4-10-19(16)24-20/h1-12H |
| InChIKey | LGGGSJKWLYKHDB-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |