2-(iodoamino)butanoic acid

C4H8INO2 — CID 23443212

IUPAC2-(iodoamino)butanoic acid
SMILESCCC(NI)C(=O)O
InChIInChI=1S/C4H8INO2/c1-2-3(6-5)4(7)8/h3,6H,2H2,1H3,(H,7,8)
InChIKeyYHJRZBYQTVPEAY-UHFFFAOYSA-N
MW229.02 g/mol
LogP0.79
Rot. Bonds3

About 2-(iodoamino)butanoic acid

2-(iodoamino)butanoic acid (PubChem CID 23443212) has the molecular formula C4H8INO2 and a molecular weight of 229.02 g/mol. Its IUPAC name is 2-(iodoamino)butanoic acid.

Molecular Properties

Compound Name2-(iodoamino)butanoic acid
PubChem CID23443212
Molecular FormulaC4H8INO2
Molecular Weight229.02 g/mol
Exact Mass228.96
IUPAC Name2-(iodoamino)butanoic acid
SMILESCCC(NI)C(=O)O
InChIInChI=1S/C4H8INO2/c1-2-3(6-5)4(7)8/h3,6H,2H2,1H3,(H,7,8)
InChIKeyYHJRZBYQTVPEAY-UHFFFAOYSA-N
XLogP0.79
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.02
LogP ≤ 50.79
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}

Analyze 2-(iodoamino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(iodoamino)butanoic acid?
The IUPAC name of 2-(iodoamino)butanoic acid (CID 23443212) is 2-(iodoamino)butanoic acid.
What is the SMILES notation for 2-(iodoamino)butanoic acid?
The canonical SMILES for 2-(iodoamino)butanoic acid is CCC(NI)C(=O)O.
What is the InChIKey of 2-(iodoamino)butanoic acid?
The InChIKey is YHJRZBYQTVPEAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8INO2/c1-2-3(6-5)4(7)8/h3,6H,2H2,1H3,(H,7,8).
What are the key properties of 2-(iodoamino)butanoic acid?
2-(iodoamino)butanoic acid has a molecular weight of 229.02 g/mol, XLogP of 0.79, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(iodoamino)butanoic acid is sourced from PubChem (CID 23443212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).