About 2-(iodoamino)butanoic acid
2-(iodoamino)butanoic acid (PubChem CID 23443212) has the molecular formula C4H8INO2
and a molecular weight of 229.02 g/mol. Its IUPAC name is 2-(iodoamino)butanoic acid.
Molecular Properties
| Compound Name | 2-(iodoamino)butanoic acid |
| PubChem CID | 23443212 |
| Molecular Formula | C4H8INO2 |
| Molecular Weight | 229.02 g/mol |
| Exact Mass | 228.96 |
| IUPAC Name | 2-(iodoamino)butanoic acid |
| SMILES | CCC(NI)C(=O)O |
| InChI | InChI=1S/C4H8INO2/c1-2-3(6-5)4(7)8/h3,6H,2H2,1H3,(H,7,8) |
| InChIKey | YHJRZBYQTVPEAY-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.02 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-(iodoamino)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(iodoamino)butanoic acid?
The IUPAC name of 2-(iodoamino)butanoic acid (CID 23443212) is 2-(iodoamino)butanoic acid.
What is the SMILES notation for 2-(iodoamino)butanoic acid?
The canonical SMILES for 2-(iodoamino)butanoic acid is CCC(NI)C(=O)O.
What is the InChIKey of 2-(iodoamino)butanoic acid?
The InChIKey is YHJRZBYQTVPEAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8INO2/c1-2-3(6-5)4(7)8/h3,6H,2H2,1H3,(H,7,8).
What are the key properties of 2-(iodoamino)butanoic acid?
2-(iodoamino)butanoic acid has a molecular weight of 229.02 g/mol, XLogP of 0.79, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(iodoamino)butanoic acid is sourced from PubChem (CID 23443212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).