About (E)-but-2-enoyl azide
(E)-but-2-enoyl azide (PubChem CID 23443326) has the molecular formula C4H5N3O
and a molecular weight of 111.10 g/mol. Its IUPAC name is (E)-but-2-enoyl azide.
Molecular Properties
| Compound Name | (E)-but-2-enoyl azide |
| PubChem CID | 23443326 |
| Molecular Formula | C4H5N3O |
| Molecular Weight | 111.10 g/mol |
| Exact Mass | 111.04 |
| IUPAC Name | (E)-but-2-enoyl azide |
| SMILES | C/C=C/C(=O)N=[N+]=[N-] |
| InChI | InChI=1S/C4H5N3O/c1-2-3-4(8)6-7-5/h2-3H,1H3/b3-2+ |
| InChIKey | NXUSZMKDZBGZRT-NSCUHMNNSA-N |
| XLogP | 1.40 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.10 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enoyl azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enoyl azide?
The IUPAC name of (E)-but-2-enoyl azide (CID 23443326) is (E)-but-2-enoyl azide.
What is the SMILES notation for (E)-but-2-enoyl azide?
The canonical SMILES for (E)-but-2-enoyl azide is C/C=C/C(=O)N=[N+]=[N-].
What is the InChIKey of (E)-but-2-enoyl azide?
The InChIKey is NXUSZMKDZBGZRT-NSCUHMNNSA-N. The full InChI is InChI=1S/C4H5N3O/c1-2-3-4(8)6-7-5/h2-3H,1H3/b3-2+.
What are the key properties of (E)-but-2-enoyl azide?
(E)-but-2-enoyl azide has a molecular weight of 111.10 g/mol, XLogP of 1.40, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enoyl azide is sourced from PubChem (CID 23443326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).