About 2-fluoro-1,3-dimethylcyclohexene
2-fluoro-1,3-dimethylcyclohexene (PubChem CID 23443583) has the molecular formula C8H13F
and a molecular weight of 128.19 g/mol. Its IUPAC name is 2-fluoro-1,3-dimethylcyclohexene.
Molecular Properties
| Compound Name | 2-fluoro-1,3-dimethylcyclohexene |
| PubChem CID | 23443583 |
| Molecular Formula | C8H13F |
| Molecular Weight | 128.19 g/mol |
| Exact Mass | 128.10 |
| IUPAC Name | 2-fluoro-1,3-dimethylcyclohexene |
| SMILES | CC1=C(F)C(C)CCC1 |
| InChI | InChI=1S/C8H13F/c1-6-4-3-5-7(2)8(6)9/h6H,3-5H2,1-2H3 |
| InChIKey | CEPPWWXESWOESF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.19 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-fluoro-1,3-dimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1,3-dimethylcyclohexene?
The IUPAC name of 2-fluoro-1,3-dimethylcyclohexene (CID 23443583) is 2-fluoro-1,3-dimethylcyclohexene.
What is the SMILES notation for 2-fluoro-1,3-dimethylcyclohexene?
The canonical SMILES for 2-fluoro-1,3-dimethylcyclohexene is CC1=C(F)C(C)CCC1.
What is the InChIKey of 2-fluoro-1,3-dimethylcyclohexene?
The InChIKey is CEPPWWXESWOESF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F/c1-6-4-3-5-7(2)8(6)9/h6H,3-5H2,1-2H3.
What are the key properties of 2-fluoro-1,3-dimethylcyclohexene?
2-fluoro-1,3-dimethylcyclohexene has a molecular weight of 128.19 g/mol, XLogP of 3.05, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1,3-dimethylcyclohexene is sourced from PubChem (CID 23443583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).