C16H13BrN2O5S2 — CID 23445317
(3-methylphenyl) 3-[(4-bromo-3-methyl-1,2-oxazol-5-yl)sulfamoyl]thiophene-2-carboxylate (PubChem CID 23445317) has the molecular formula C16H13BrN2O5S2 and a molecular weight of 457.33 g/mol. Its IUPAC name is (3-methylphenyl) 3-[(4-bromo-3-methyl-1,2-oxazol-5-yl)sulfamoyl]thiophene-2-carboxylate.
| Compound Name | (3-methylphenyl) 3-[(4-bromo-3-methyl-1,2-oxazol-5-yl)sulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 23445317 |
| Molecular Formula | C16H13BrN2O5S2 |
| Molecular Weight | 457.33 g/mol |
| Exact Mass | 455.94 |
| IUPAC Name | (3-methylphenyl) 3-[(4-bromo-3-methyl-1,2-oxazol-5-yl)sulfamoyl]thiophene-2-carboxylate |
| SMILES | Cc1cccc(OC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Br)c1 |
| InChI | InChI=1S/C16H13BrN2O5S2/c1-9-4-3-5-11(8-9)23-16(20)14-12(6-7-25-14)26(21,22)19-15-13(17)10(2)18-24-15/h3-8,19H,1-2H3 |
| InChIKey | PFFISQSGKLUPSY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|