About 4-(3,5-dimethylphenyl)-N-(3-methoxyquinoxalin-2-yl)piperazine-1-carboxamide
4-(3,5-dimethylphenyl)-N-(3-methoxyquinoxalin-2-yl)piperazine-1-carboxamide (PubChem CID 23446362) has the molecular formula C22H25N5O2
and a molecular weight of 391.48 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)-N-(3-methoxyquinoxalin-2-yl)piperazine-1-carboxamide.
Molecular Properties
| Compound Name | 4-(3,5-dimethylphenyl)-N-(3-methoxyquinoxalin-2-yl)piperazine-1-carboxamide |
| PubChem CID | 23446362 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 4-(3,5-dimethylphenyl)-N-(3-methoxyquinoxalin-2-yl)piperazine-1-carboxamide |
| SMILES | COc1nc2ccccc2nc1NC(=O)N1CCN(c2cc(C)cc(C)c2)CC1 |
| InChI | InChI=1S/C22H25N5O2/c1-15-12-16(2)14-17(13-15)26-8-10-27(11-9-26)22(28)25-20-21(29-3)24-19-7-5-4-6-18(19)23-20/h4-7,12-14H,8-11H2,1-3H3,(H,23,25,28) |
| InChIKey | VUGPAVZLAQRHCV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3,5-dimethylphenyl)-N-(3-methoxyquinoxalin-2-yl)piperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dimethylphenyl)-N-(3-methoxyquinoxalin-2-yl)piperazine-1-carboxamide?
The IUPAC name of 4-(3,5-dimethylphenyl)-N-(3-methoxyquinoxalin-2-yl)piperazine-1-carboxamide (CID 23446362) is 4-(3,5-dimethylphenyl)-N-(3-methoxyquinoxalin-2-yl)piperazine-1-carboxamide.
What is the SMILES notation for 4-(3,5-dimethylphenyl)-N-(3-methoxyquinoxalin-2-yl)piperazine-1-carboxamide?
The canonical SMILES for 4-(3,5-dimethylphenyl)-N-(3-methoxyquinoxalin-2-yl)piperazine-1-carboxamide is COc1nc2ccccc2nc1NC(=O)N1CCN(c2cc(C)cc(C)c2)CC1.
What is the InChIKey of 4-(3,5-dimethylphenyl)-N-(3-methoxyquinoxalin-2-yl)piperazine-1-carboxamide?
The InChIKey is VUGPAVZLAQRHCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N5O2/c1-15-12-16(2)14-17(13-15)26-8-10-27(11-9-26)22(28)25-20-21(29-3)24-19-7-5-4-6-18(19)23-20/h4-7,12-14H,8-11H2,1-3H3,(H,23,25,28).
What are the key properties of 4-(3,5-dimethylphenyl)-N-(3-methoxyquinoxalin-2-yl)piperazine-1-carboxamide?
4-(3,5-dimethylphenyl)-N-(3-methoxyquinoxalin-2-yl)piperazine-1-carboxamide has a molecular weight of 391.48 g/mol, XLogP of 3.61, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethylphenyl)-N-(3-methoxyquinoxalin-2-yl)piperazine-1-carboxamide is sourced from PubChem (CID 23446362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).