About 2-amino-6-(5,6-dichlorotriazin-4-yl)benzenesulfonic acid
2-amino-6-(5,6-dichlorotriazin-4-yl)benzenesulfonic acid (PubChem CID 23446972) has the molecular formula C9H6Cl2N4O3S
and a molecular weight of 321.15 g/mol. Its IUPAC name is 2-amino-6-(5,6-dichlorotriazin-4-yl)benzenesulfonic acid.
Molecular Properties
| Compound Name | 2-amino-6-(5,6-dichlorotriazin-4-yl)benzenesulfonic acid |
| PubChem CID | 23446972 |
| Molecular Formula | C9H6Cl2N4O3S |
| Molecular Weight | 321.15 g/mol |
| Exact Mass | 319.95 |
| IUPAC Name | 2-amino-6-(5,6-dichlorotriazin-4-yl)benzenesulfonic acid |
| SMILES | Nc1cccc(-c2nnnc(Cl)c2Cl)c1S(=O)(=O)O |
| InChI | InChI=1S/C9H6Cl2N4O3S/c10-6-7(13-15-14-9(6)11)4-2-1-3-5(12)8(4)19(16,17)18/h1-3H,12H2,(H,16,17,18) |
| InChIKey | QUAKZLOBZJBSFZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 119.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.15 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-(5,6-dichlorotriazin-4-yl)benzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-(5,6-dichlorotriazin-4-yl)benzenesulfonic acid?
The IUPAC name of 2-amino-6-(5,6-dichlorotriazin-4-yl)benzenesulfonic acid (CID 23446972) is 2-amino-6-(5,6-dichlorotriazin-4-yl)benzenesulfonic acid.
What is the SMILES notation for 2-amino-6-(5,6-dichlorotriazin-4-yl)benzenesulfonic acid?
The canonical SMILES for 2-amino-6-(5,6-dichlorotriazin-4-yl)benzenesulfonic acid is Nc1cccc(-c2nnnc(Cl)c2Cl)c1S(=O)(=O)O.
What is the InChIKey of 2-amino-6-(5,6-dichlorotriazin-4-yl)benzenesulfonic acid?
The InChIKey is QUAKZLOBZJBSFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6Cl2N4O3S/c10-6-7(13-15-14-9(6)11)4-2-1-3-5(12)8(4)19(16,17)18/h1-3H,12H2,(H,16,17,18).
What are the key properties of 2-amino-6-(5,6-dichlorotriazin-4-yl)benzenesulfonic acid?
2-amino-6-(5,6-dichlorotriazin-4-yl)benzenesulfonic acid has a molecular weight of 321.15 g/mol, XLogP of 1.67, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-(5,6-dichlorotriazin-4-yl)benzenesulfonic acid is sourced from PubChem (CID 23446972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).