About 2-ethylsulfanylethoxy-dimethoxy-sulfanylidene-λ5-phosphane
2-ethylsulfanylethoxy-dimethoxy-sulfanylidene-λ5-phosphane (PubChem CID 23447081) has the molecular formula C12H30O6P2S4
and a molecular weight of 460.58 g/mol. Its IUPAC name is 2-ethylsulfanylethoxy-dimethoxy-sulfanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | 2-ethylsulfanylethoxy-dimethoxy-sulfanylidene-λ5-phosphane |
| PubChem CID | 23447081 |
| Molecular Formula | C12H30O6P2S4 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | 2-ethylsulfanylethoxy-dimethoxy-sulfanylidene-λ5-phosphane |
| SMILES | CCSCCOP(=S)(OC)OC.CCSCCOP(=S)(OC)OC |
| InChI | InChI=1S/2C6H15O3PS2/c2*1-4-12-6-5-9-10(11,7-2)8-3/h2*4-6H2,1-3H3 |
| InChIKey | ZGHQSBHMTDKNBG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylsulfanylethoxy-dimethoxy-sulfanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfanylethoxy-dimethoxy-sulfanylidene-λ5-phosphane?
The IUPAC name of 2-ethylsulfanylethoxy-dimethoxy-sulfanylidene-λ5-phosphane (CID 23447081) is 2-ethylsulfanylethoxy-dimethoxy-sulfanylidene-λ5-phosphane.
What is the SMILES notation for 2-ethylsulfanylethoxy-dimethoxy-sulfanylidene-λ5-phosphane?
The canonical SMILES for 2-ethylsulfanylethoxy-dimethoxy-sulfanylidene-λ5-phosphane is CCSCCOP(=S)(OC)OC.CCSCCOP(=S)(OC)OC.
What is the InChIKey of 2-ethylsulfanylethoxy-dimethoxy-sulfanylidene-λ5-phosphane?
The InChIKey is ZGHQSBHMTDKNBG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H15O3PS2/c2*1-4-12-6-5-9-10(11,7-2)8-3/h2*4-6H2,1-3H3.
What are the key properties of 2-ethylsulfanylethoxy-dimethoxy-sulfanylidene-λ5-phosphane?
2-ethylsulfanylethoxy-dimethoxy-sulfanylidene-λ5-phosphane has a molecular weight of 460.58 g/mol, XLogP of 4.55, 14 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfanylethoxy-dimethoxy-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 23447081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).