6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride

C10H8Cl2O2S — CID 23447303

IUPAC6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride
SMILESO=S(=O)(Cl)C1=Cc2ccc(Cl)cc2CC1
InChIInChI=1S/C10H8Cl2O2S/c11-9-3-1-8-6-10(15(12,13)14)4-2-7(8)5-9/h1,3,5-6H,2,4H2
InChIKeyDJYIITUZFKBOAY-UHFFFAOYSA-N
MW263.14 g/mol
LogP3.20
Rot. Bonds1

About 6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride

6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride (PubChem CID 23447303) has the molecular formula C10H8Cl2O2S and a molecular weight of 263.14 g/mol. Its IUPAC name is 6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride.

Molecular Properties

Compound Name6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride
PubChem CID23447303
Molecular FormulaC10H8Cl2O2S
Molecular Weight263.14 g/mol
Exact Mass261.96
IUPAC Name6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride
SMILESO=S(=O)(Cl)C1=Cc2ccc(Cl)cc2CC1
InChIInChI=1S/C10H8Cl2O2S/c11-9-3-1-8-6-10(15(12,13)14)4-2-7(8)5-9/h1,3,5-6H,2,4H2
InChIKeyDJYIITUZFKBOAY-UHFFFAOYSA-N
XLogP3.20
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.14
LogP ≤ 53.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride?
The IUPAC name of 6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride (CID 23447303) is 6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride.
What is the SMILES notation for 6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride?
The canonical SMILES for 6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride is O=S(=O)(Cl)C1=Cc2ccc(Cl)cc2CC1.
What is the InChIKey of 6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride?
The InChIKey is DJYIITUZFKBOAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Cl2O2S/c11-9-3-1-8-6-10(15(12,13)14)4-2-7(8)5-9/h1,3,5-6H,2,4H2.
What are the key properties of 6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride?
6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride has a molecular weight of 263.14 g/mol, XLogP of 3.20, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride is sourced from PubChem (CID 23447303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).