About 6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride
6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride (PubChem CID 23447303) has the molecular formula C10H8Cl2O2S
and a molecular weight of 263.14 g/mol. Its IUPAC name is 6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride.
Molecular Properties
| Compound Name | 6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride |
| PubChem CID | 23447303 |
| Molecular Formula | C10H8Cl2O2S |
| Molecular Weight | 263.14 g/mol |
| Exact Mass | 261.96 |
| IUPAC Name | 6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)C1=Cc2ccc(Cl)cc2CC1 |
| InChI | InChI=1S/C10H8Cl2O2S/c11-9-3-1-8-6-10(15(12,13)14)4-2-7(8)5-9/h1,3,5-6H,2,4H2 |
| InChIKey | DJYIITUZFKBOAY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.14 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride?
The IUPAC name of 6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride (CID 23447303) is 6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride.
What is the SMILES notation for 6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride?
The canonical SMILES for 6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride is O=S(=O)(Cl)C1=Cc2ccc(Cl)cc2CC1.
What is the InChIKey of 6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride?
The InChIKey is DJYIITUZFKBOAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Cl2O2S/c11-9-3-1-8-6-10(15(12,13)14)4-2-7(8)5-9/h1,3,5-6H,2,4H2.
What are the key properties of 6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride?
6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride has a molecular weight of 263.14 g/mol, XLogP of 3.20, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3,4-dihydronaphthalene-2-sulfonyl chloride is sourced from PubChem (CID 23447303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).