C19H10N2O2 — CID 23448044
5,12-diazapentacyclo[11.8.0.02,10.03,8.014,19]henicosa-1(13),2(10),3(8),4,6,14,16,18,20-nonaene-9,11-dione (PubChem CID 23448044) has the molecular formula C19H10N2O2 and a molecular weight of 298.30 g/mol. Its IUPAC name is 5,12-diazapentacyclo[11.8.0.02,10.03,8.014,19]henicosa-1(13),2(10),3(8),4,6,14,16,18,20-nonaene-9,11-dione.
| Compound Name | 5,12-diazapentacyclo[11.8.0.02,10.03,8.014,19]henicosa-1(13),2(10),3(8),4,6,14,16,18,20-nonaene-9,11-dione |
|---|---|
| PubChem CID | 23448044 |
| Molecular Formula | C19H10N2O2 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 5,12-diazapentacyclo[11.8.0.02,10.03,8.014,19]henicosa-1(13),2(10),3(8),4,6,14,16,18,20-nonaene-9,11-dione |
| SMILES | O=C1c2ccncc2-c2c1c(=O)[nH]c1c2ccc2ccccc21 |
| InChI | InChI=1S/C19H10N2O2/c22-18-12-7-8-20-9-14(12)15-13-6-5-10-3-1-2-4-11(10)17(13)21-19(23)16(15)18/h1-9H,(H,21,23) |
| InChIKey | DVJCGGLWWDMJPP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|