C28H15F15O4S2 — CID 23448540
difluoro-[2,2,3,3,4,5,5-heptafluoro-6-oxo-7,7-bis(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methanesulfonate;triphenylsulfanium (PubChem CID 23448540) has the molecular formula C28H15F15O4S2 and a molecular weight of 764.53 g/mol. Its IUPAC name is difluoro-[2,2,3,3,4,5,5-heptafluoro-6-oxo-7,7-bis(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methanesulfonate;triphenylsulfanium.
| Compound Name | difluoro-[2,2,3,3,4,5,5-heptafluoro-6-oxo-7,7-bis(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methanesulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 23448540 |
| Molecular Formula | C28H15F15O4S2 |
| Molecular Weight | 764.53 g/mol |
| Exact Mass | 764.02 |
| IUPAC Name | difluoro-[2,2,3,3,4,5,5-heptafluoro-6-oxo-7,7-bis(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methanesulfonate;triphenylsulfanium |
| SMILES | O=C1C(F)(F)C2(F)C(F)(F)C(F)(F)C1(C(F)(F)S(=O)(=O)[O-])C2(C(F)(F)F)C(F)(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C10HF15O4S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;11-3(12)1(26)2(10(24,25)30(27,28)29)4(8(18,19)20,9(21,22)23)5(3,13)7(16,17)6(2,14)15/h1-15H;(H,27,28,29)/q+1;/p-1 |
| InChIKey | OIJGZNLZFXIFES-UHFFFAOYSA-M |
| XLogP | 8.21 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.53 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|