About bis(2,4,6-trifluorophenyl) oxalate
bis(2,4,6-trifluorophenyl) oxalate (PubChem CID 23448587) has the molecular formula C14H4F6O4
and a molecular weight of 350.17 g/mol. Its IUPAC name is bis(2,4,6-trifluorophenyl) oxalate.
Molecular Properties
| Compound Name | bis(2,4,6-trifluorophenyl) oxalate |
| PubChem CID | 23448587 |
| Molecular Formula | C14H4F6O4 |
| Molecular Weight | 350.17 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | bis(2,4,6-trifluorophenyl) oxalate |
| SMILES | O=C(Oc1c(F)cc(F)cc1F)C(=O)Oc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C14H4F6O4/c15-5-1-7(17)11(8(18)2-5)23-13(21)14(22)24-12-9(19)3-6(16)4-10(12)20/h1-4H |
| InChIKey | ZKTXWEOGJKXZRT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.17 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze bis(2,4,6-trifluorophenyl) oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,4,6-trifluorophenyl) oxalate?
The IUPAC name of bis(2,4,6-trifluorophenyl) oxalate (CID 23448587) is bis(2,4,6-trifluorophenyl) oxalate.
What is the SMILES notation for bis(2,4,6-trifluorophenyl) oxalate?
The canonical SMILES for bis(2,4,6-trifluorophenyl) oxalate is O=C(Oc1c(F)cc(F)cc1F)C(=O)Oc1c(F)cc(F)cc1F.
What is the InChIKey of bis(2,4,6-trifluorophenyl) oxalate?
The InChIKey is ZKTXWEOGJKXZRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H4F6O4/c15-5-1-7(17)11(8(18)2-5)23-13(21)14(22)24-12-9(19)3-6(16)4-10(12)20/h1-4H.
What are the key properties of bis(2,4,6-trifluorophenyl) oxalate?
bis(2,4,6-trifluorophenyl) oxalate has a molecular weight of 350.17 g/mol, XLogP of 3.03, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,4,6-trifluorophenyl) oxalate is sourced from PubChem (CID 23448587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).