C18H24 — CID 23448609
pentacyclo[12.2.1.16,9.02,13.05,10]octadeca-7,15-diene (PubChem CID 23448609) has the molecular formula C18H24 and a molecular weight of 240.39 g/mol. Its IUPAC name is pentacyclo[12.2.1.16,9.02,13.05,10]octadeca-7,15-diene.
| Compound Name | pentacyclo[12.2.1.16,9.02,13.05,10]octadeca-7,15-diene |
|---|---|
| PubChem CID | 23448609 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | pentacyclo[12.2.1.16,9.02,13.05,10]octadeca-7,15-diene |
| SMILES | C1=CC2CC1C1CCC3C4C=CC(C4)C3CCC21 |
| InChI | InChI=1S/C18H24/c1-2-12-9-11(1)15-5-6-17-13-3-4-14(10-13)18(17)8-7-16(12)15/h1-4,11-18H,5-10H2 |
| InChIKey | UJTWNCUPDNMVGV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|