About 7-fluoroimidazo[5,1-b][1,3]thiazole
7-fluoroimidazo[5,1-b][1,3]thiazole (PubChem CID 23449270) has the molecular formula C5H3FN2S
and a molecular weight of 142.16 g/mol. Its IUPAC name is 7-fluoroimidazo[5,1-b][1,3]thiazole.
Molecular Properties
| Compound Name | 7-fluoroimidazo[5,1-b][1,3]thiazole |
|---|
| PubChem CID | 23449270 |
|---|
| Molecular Formula | C5H3FN2S |
|---|
| Molecular Weight | 142.16 g/mol |
|---|
| Exact Mass | 142.00 |
|---|
| IUPAC Name | 7-fluoroimidazo[5,1-b][1,3]thiazole |
|---|
| SMILES | Fc1ncn2ccsc12 |
|---|
| InChI | InChI=1S/C5H3FN2S/c6-4-5-8(3-7-4)1-2-9-5/h1-3H |
|---|
| InChIKey | DLEAHJSBGRSTHX-UHFFFAOYSA-N |
|---|
| XLogP | 1.53 |
|---|
| TPSA | 17.30 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 3 |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 9 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-fluoroimidazo[5,1-b][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoroimidazo[5,1-b][1,3]thiazole?
The IUPAC name of 7-fluoroimidazo[5,1-b][1,3]thiazole (CID 23449270) is 7-fluoroimidazo[5,1-b][1,3]thiazole.
What is the SMILES notation for 7-fluoroimidazo[5,1-b][1,3]thiazole?
The canonical SMILES for 7-fluoroimidazo[5,1-b][1,3]thiazole is Fc1ncn2ccsc12.
What is the InChIKey of 7-fluoroimidazo[5,1-b][1,3]thiazole?
The InChIKey is DLEAHJSBGRSTHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3FN2S/c6-4-5-8(3-7-4)1-2-9-5/h1-3H.
What are the key properties of 7-fluoroimidazo[5,1-b][1,3]thiazole?
7-fluoroimidazo[5,1-b][1,3]thiazole has a molecular weight of 142.16 g/mol, XLogP of 1.53, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoroimidazo[5,1-b][1,3]thiazole is sourced from PubChem (CID 23449270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).