C32H39FN7O+ — CID 23449901
4-(4-fluorophenyl)-1-methyl-5-[2-(1-phenylethylamino)pyrimidin-4-yl]-2,2-di(piperidin-4-yl)pyrazol-2-ium-3-one (PubChem CID 23449901) has the molecular formula C32H39FN7O+ and a molecular weight of 556.71 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1-methyl-5-[2-(1-phenylethylamino)pyrimidin-4-yl]-2,2-di(piperidin-4-yl)pyrazol-2-ium-3-one.
| Compound Name | 4-(4-fluorophenyl)-1-methyl-5-[2-(1-phenylethylamino)pyrimidin-4-yl]-2,2-di(piperidin-4-yl)pyrazol-2-ium-3-one |
|---|---|
| PubChem CID | 23449901 |
| Molecular Formula | C32H39FN7O+ |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.32 |
| IUPAC Name | 4-(4-fluorophenyl)-1-methyl-5-[2-(1-phenylethylamino)pyrimidin-4-yl]-2,2-di(piperidin-4-yl)pyrazol-2-ium-3-one |
| SMILES | CC(Nc1nccc(C2=C(c3ccc(F)cc3)C(=O)[N+](C3CCNCC3)(C3CCNCC3)N2C)n1)c1ccccc1 |
| InChI | InChI=1S/C32H39FN7O/c1-22(23-6-4-3-5-7-23)37-32-36-21-16-28(38-32)30-29(24-8-10-25(33)11-9-24)31(41)40(39(30)2,26-12-17-34-18-13-26)27-14-19-35-20-15-27/h3-11,16,21-22,26-27,34-35H,12-15,17-20H2,1-2H3,(H,36,37,38)/q+1 |
| InChIKey | GNTXMLWXVCKWMI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|