C30H30F2N4O6 — CID 23450012
tert-butyl N-[2-[3-[(2,6-difluorophenyl)methyl]-5-(3-methoxyphenyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]-1-phenylethyl]carbamate (PubChem CID 23450012) has the molecular formula C30H30F2N4O6 and a molecular weight of 580.59 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[(2,6-difluorophenyl)methyl]-5-(3-methoxyphenyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]-1-phenylethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[(2,6-difluorophenyl)methyl]-5-(3-methoxyphenyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 23450012 |
| Molecular Formula | C30H30F2N4O6 |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | tert-butyl N-[2-[3-[(2,6-difluorophenyl)methyl]-5-(3-methoxyphenyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]-1-phenylethyl]carbamate |
| SMILES | COc1cccc(-n2c(=O)n(Cc3c(F)cccc3F)c(=O)n(CC(NC(=O)OC(C)(C)C)c3ccccc3)c2=O)c1 |
| InChI | InChI=1S/C30H30F2N4O6/c1-30(2,3)42-26(37)33-25(19-10-6-5-7-11-19)18-35-27(38)34(17-22-23(31)14-9-15-24(22)32)28(39)36(29(35)40)20-12-8-13-21(16-20)41-4/h5-16,25H,17-18H2,1-4H3,(H,33,37) |
| InChIKey | DZGRGKGJOBECQA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 113.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |