C11H14S — CID 23450672
3,4,7-trimethyl-2,7a-dihydro-1-benzothiophene (PubChem CID 23450672) has the molecular formula C11H14S and a molecular weight of 178.30 g/mol. Its IUPAC name is 3,4,7-trimethyl-2,7a-dihydro-1-benzothiophene.
| Compound Name | 3,4,7-trimethyl-2,7a-dihydro-1-benzothiophene |
|---|---|
| PubChem CID | 23450672 |
| Molecular Formula | C11H14S |
| Molecular Weight | 178.30 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 3,4,7-trimethyl-2,7a-dihydro-1-benzothiophene |
| SMILES | CC1=CC=C(C)C2SCC(C)=C12 |
| InChI | InChI=1S/C11H14S/c1-7-4-5-8(2)11-10(7)9(3)6-12-11/h4-5,11H,6H2,1-3H3 |
| InChIKey | UMWHPPANFMUYIY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |