About 5-chloro-1,3-difluoro-2-(trifluoromethyl)benzene
5-chloro-1,3-difluoro-2-(trifluoromethyl)benzene (PubChem CID 23450922) has the molecular formula C7H2ClF5
and a molecular weight of 216.54 g/mol. Its IUPAC name is 5-chloro-1,3-difluoro-2-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 5-chloro-1,3-difluoro-2-(trifluoromethyl)benzene |
| PubChem CID | 23450922 |
| Molecular Formula | C7H2ClF5 |
| Molecular Weight | 216.54 g/mol |
| Exact Mass | 215.98 |
| IUPAC Name | 5-chloro-1,3-difluoro-2-(trifluoromethyl)benzene |
| SMILES | Fc1cc(Cl)cc(F)c1C(F)(F)F |
| InChI | InChI=1S/C7H2ClF5/c8-3-1-4(9)6(5(10)2-3)7(11,12)13/h1-2H |
| InChIKey | SGJLWILHBZITFS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.54 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-chloro-1,3-difluoro-2-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1,3-difluoro-2-(trifluoromethyl)benzene?
The IUPAC name of 5-chloro-1,3-difluoro-2-(trifluoromethyl)benzene (CID 23450922) is 5-chloro-1,3-difluoro-2-(trifluoromethyl)benzene.
What is the SMILES notation for 5-chloro-1,3-difluoro-2-(trifluoromethyl)benzene?
The canonical SMILES for 5-chloro-1,3-difluoro-2-(trifluoromethyl)benzene is Fc1cc(Cl)cc(F)c1C(F)(F)F.
What is the InChIKey of 5-chloro-1,3-difluoro-2-(trifluoromethyl)benzene?
The InChIKey is SGJLWILHBZITFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2ClF5/c8-3-1-4(9)6(5(10)2-3)7(11,12)13/h1-2H.
What are the key properties of 5-chloro-1,3-difluoro-2-(trifluoromethyl)benzene?
5-chloro-1,3-difluoro-2-(trifluoromethyl)benzene has a molecular weight of 216.54 g/mol, XLogP of 3.64, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,3-difluoro-2-(trifluoromethyl)benzene is sourced from PubChem (CID 23450922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).