C19H9F8NO2S — CID 23451005
4-[2,3,4,5-tetrafluoro-6-[3-fluoro-4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide (PubChem CID 23451005) has the molecular formula C19H9F8NO2S and a molecular weight of 467.34 g/mol. Its IUPAC name is 4-[2,3,4,5-tetrafluoro-6-[3-fluoro-4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide.
| Compound Name | 4-[2,3,4,5-tetrafluoro-6-[3-fluoro-4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 23451005 |
| Molecular Formula | C19H9F8NO2S |
| Molecular Weight | 467.34 g/mol |
| Exact Mass | 467.02 |
| IUPAC Name | 4-[2,3,4,5-tetrafluoro-6-[3-fluoro-4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2c(F)c(F)c(F)c(F)c2-c2ccc(C(F)(F)F)c(F)c2)cc1 |
| InChI | InChI=1S/C19H9F8NO2S/c20-12-7-9(3-6-11(12)19(25,26)27)14-13(15(21)17(23)18(24)16(14)22)8-1-4-10(5-2-8)31(28,29)30/h1-7H,(H2,28,29,30) |
| InChIKey | XTIYSQRTBDHIKN-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.34 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|