About 4-[2-[3,5-bis(dimethylamino)-4-fluorophenyl]phenyl]benzenesulfonamide
4-[2-[3,5-bis(dimethylamino)-4-fluorophenyl]phenyl]benzenesulfonamide (PubChem CID 23451025) has the molecular formula C22H24FN3O2S
and a molecular weight of 413.52 g/mol. Its IUPAC name is 4-[2-[3,5-bis(dimethylamino)-4-fluorophenyl]phenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[2-[3,5-bis(dimethylamino)-4-fluorophenyl]phenyl]benzenesulfonamide |
| PubChem CID | 23451025 |
| Molecular Formula | C22H24FN3O2S |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 4-[2-[3,5-bis(dimethylamino)-4-fluorophenyl]phenyl]benzenesulfonamide |
| SMILES | CN(C)c1cc(-c2ccccc2-c2ccc(S(N)(=O)=O)cc2)cc(N(C)C)c1F |
| InChI | InChI=1S/C22H24FN3O2S/c1-25(2)20-13-16(14-21(22(20)23)26(3)4)19-8-6-5-7-18(19)15-9-11-17(12-10-15)29(24,27)28/h5-14H,1-4H3,(H2,24,27,28) |
| InChIKey | DVSCBQUMTOUJNG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-[3,5-bis(dimethylamino)-4-fluorophenyl]phenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[3,5-bis(dimethylamino)-4-fluorophenyl]phenyl]benzenesulfonamide?
The IUPAC name of 4-[2-[3,5-bis(dimethylamino)-4-fluorophenyl]phenyl]benzenesulfonamide (CID 23451025) is 4-[2-[3,5-bis(dimethylamino)-4-fluorophenyl]phenyl]benzenesulfonamide.
What is the SMILES notation for 4-[2-[3,5-bis(dimethylamino)-4-fluorophenyl]phenyl]benzenesulfonamide?
The canonical SMILES for 4-[2-[3,5-bis(dimethylamino)-4-fluorophenyl]phenyl]benzenesulfonamide is CN(C)c1cc(-c2ccccc2-c2ccc(S(N)(=O)=O)cc2)cc(N(C)C)c1F.
What is the InChIKey of 4-[2-[3,5-bis(dimethylamino)-4-fluorophenyl]phenyl]benzenesulfonamide?
The InChIKey is DVSCBQUMTOUJNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24FN3O2S/c1-25(2)20-13-16(14-21(22(20)23)26(3)4)19-8-6-5-7-18(19)15-9-11-17(12-10-15)29(24,27)28/h5-14H,1-4H3,(H2,24,27,28).
What are the key properties of 4-[2-[3,5-bis(dimethylamino)-4-fluorophenyl]phenyl]benzenesulfonamide?
4-[2-[3,5-bis(dimethylamino)-4-fluorophenyl]phenyl]benzenesulfonamide has a molecular weight of 413.52 g/mol, XLogP of 3.94, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[3,5-bis(dimethylamino)-4-fluorophenyl]phenyl]benzenesulfonamide is sourced from PubChem (CID 23451025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).