About 5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methoxy-1,3-dimethylbenzene
5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methoxy-1,3-dimethylbenzene (PubChem CID 23451103) has the molecular formula C22H20F2O3S
and a molecular weight of 402.46 g/mol. Its IUPAC name is 5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methoxy-1,3-dimethylbenzene.
Molecular Properties
| Compound Name | 5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methoxy-1,3-dimethylbenzene |
| PubChem CID | 23451103 |
| Molecular Formula | C22H20F2O3S |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methoxy-1,3-dimethylbenzene |
| SMILES | COc1c(C)cc(-c2cc(F)c(F)cc2-c2ccc(S(C)(=O)=O)cc2)cc1C |
| InChI | InChI=1S/C22H20F2O3S/c1-13-9-16(10-14(2)22(13)27-3)19-12-21(24)20(23)11-18(19)15-5-7-17(8-6-15)28(4,25)26/h5-12H,1-4H3 |
| InChIKey | WQIRLGKBGBFLJX-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methoxy-1,3-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methoxy-1,3-dimethylbenzene?
The IUPAC name of 5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methoxy-1,3-dimethylbenzene (CID 23451103) is 5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methoxy-1,3-dimethylbenzene.
What is the SMILES notation for 5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methoxy-1,3-dimethylbenzene?
The canonical SMILES for 5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methoxy-1,3-dimethylbenzene is COc1c(C)cc(-c2cc(F)c(F)cc2-c2ccc(S(C)(=O)=O)cc2)cc1C.
What is the InChIKey of 5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methoxy-1,3-dimethylbenzene?
The InChIKey is WQIRLGKBGBFLJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20F2O3S/c1-13-9-16(10-14(2)22(13)27-3)19-12-21(24)20(23)11-18(19)15-5-7-17(8-6-15)28(4,25)26/h5-12H,1-4H3.
What are the key properties of 5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methoxy-1,3-dimethylbenzene?
5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methoxy-1,3-dimethylbenzene has a molecular weight of 402.46 g/mol, XLogP of 5.33, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4,5-difluoro-2-(4-methylsulfonylphenyl)phenyl]-2-methoxy-1,3-dimethylbenzene is sourced from PubChem (CID 23451103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).