About 5-(3,5-dichloro-4-fluorophenyl)-6-(4-methylsulfonylphenyl)-1,3-benzodioxole
5-(3,5-dichloro-4-fluorophenyl)-6-(4-methylsulfonylphenyl)-1,3-benzodioxole (PubChem CID 23451391) has the molecular formula C20H13Cl2FO4S
and a molecular weight of 439.29 g/mol. Its IUPAC name is 5-(3,5-dichloro-4-fluorophenyl)-6-(4-methylsulfonylphenyl)-1,3-benzodioxole.
Molecular Properties
| Compound Name | 5-(3,5-dichloro-4-fluorophenyl)-6-(4-methylsulfonylphenyl)-1,3-benzodioxole |
| PubChem CID | 23451391 |
| Molecular Formula | C20H13Cl2FO4S |
| Molecular Weight | 439.29 g/mol |
| Exact Mass | 437.99 |
| IUPAC Name | 5-(3,5-dichloro-4-fluorophenyl)-6-(4-methylsulfonylphenyl)-1,3-benzodioxole |
| SMILES | CS(=O)(=O)c1ccc(-c2cc3c(cc2-c2cc(Cl)c(F)c(Cl)c2)OCO3)cc1 |
| InChI | InChI=1S/C20H13Cl2FO4S/c1-28(24,25)13-4-2-11(3-5-13)14-8-18-19(27-10-26-18)9-15(14)12-6-16(21)20(23)17(22)7-12/h2-9H,10H2,1H3 |
| InChIKey | HJMUQYFVHYTMKX-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.29 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,5-dichloro-4-fluorophenyl)-6-(4-methylsulfonylphenyl)-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,5-dichloro-4-fluorophenyl)-6-(4-methylsulfonylphenyl)-1,3-benzodioxole?
The IUPAC name of 5-(3,5-dichloro-4-fluorophenyl)-6-(4-methylsulfonylphenyl)-1,3-benzodioxole (CID 23451391) is 5-(3,5-dichloro-4-fluorophenyl)-6-(4-methylsulfonylphenyl)-1,3-benzodioxole.
What is the SMILES notation for 5-(3,5-dichloro-4-fluorophenyl)-6-(4-methylsulfonylphenyl)-1,3-benzodioxole?
The canonical SMILES for 5-(3,5-dichloro-4-fluorophenyl)-6-(4-methylsulfonylphenyl)-1,3-benzodioxole is CS(=O)(=O)c1ccc(-c2cc3c(cc2-c2cc(Cl)c(F)c(Cl)c2)OCO3)cc1.
What is the InChIKey of 5-(3,5-dichloro-4-fluorophenyl)-6-(4-methylsulfonylphenyl)-1,3-benzodioxole?
The InChIKey is HJMUQYFVHYTMKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13Cl2FO4S/c1-28(24,25)13-4-2-11(3-5-13)14-8-18-19(27-10-26-18)9-15(14)12-6-16(21)20(23)17(22)7-12/h2-9H,10H2,1H3.
What are the key properties of 5-(3,5-dichloro-4-fluorophenyl)-6-(4-methylsulfonylphenyl)-1,3-benzodioxole?
5-(3,5-dichloro-4-fluorophenyl)-6-(4-methylsulfonylphenyl)-1,3-benzodioxole has a molecular weight of 439.29 g/mol, XLogP of 5.60, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dichloro-4-fluorophenyl)-6-(4-methylsulfonylphenyl)-1,3-benzodioxole is sourced from PubChem (CID 23451391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).