About 4-[2-[4-methoxy-3,5-bis(trifluoromethyl)phenyl]phenyl]benzenesulfonamide
4-[2-[4-methoxy-3,5-bis(trifluoromethyl)phenyl]phenyl]benzenesulfonamide (PubChem CID 23451406) has the molecular formula C21H15F6NO3S
and a molecular weight of 475.41 g/mol. Its IUPAC name is 4-[2-[4-methoxy-3,5-bis(trifluoromethyl)phenyl]phenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[2-[4-methoxy-3,5-bis(trifluoromethyl)phenyl]phenyl]benzenesulfonamide |
| PubChem CID | 23451406 |
| Molecular Formula | C21H15F6NO3S |
| Molecular Weight | 475.41 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | 4-[2-[4-methoxy-3,5-bis(trifluoromethyl)phenyl]phenyl]benzenesulfonamide |
| SMILES | COc1c(C(F)(F)F)cc(-c2ccccc2-c2ccc(S(N)(=O)=O)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H15F6NO3S/c1-31-19-17(20(22,23)24)10-13(11-18(19)21(25,26)27)16-5-3-2-4-15(16)12-6-8-14(9-7-12)32(28,29)30/h2-11H,1H3,(H2,28,29,30) |
| InChIKey | PZBQGUDMJJWRFR-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.41 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-[4-methoxy-3,5-bis(trifluoromethyl)phenyl]phenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[4-methoxy-3,5-bis(trifluoromethyl)phenyl]phenyl]benzenesulfonamide?
The IUPAC name of 4-[2-[4-methoxy-3,5-bis(trifluoromethyl)phenyl]phenyl]benzenesulfonamide (CID 23451406) is 4-[2-[4-methoxy-3,5-bis(trifluoromethyl)phenyl]phenyl]benzenesulfonamide.
What is the SMILES notation for 4-[2-[4-methoxy-3,5-bis(trifluoromethyl)phenyl]phenyl]benzenesulfonamide?
The canonical SMILES for 4-[2-[4-methoxy-3,5-bis(trifluoromethyl)phenyl]phenyl]benzenesulfonamide is COc1c(C(F)(F)F)cc(-c2ccccc2-c2ccc(S(N)(=O)=O)cc2)cc1C(F)(F)F.
What is the InChIKey of 4-[2-[4-methoxy-3,5-bis(trifluoromethyl)phenyl]phenyl]benzenesulfonamide?
The InChIKey is PZBQGUDMJJWRFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15F6NO3S/c1-31-19-17(20(22,23)24)10-13(11-18(19)21(25,26)27)16-5-3-2-4-15(16)12-6-8-14(9-7-12)32(28,29)30/h2-11H,1H3,(H2,28,29,30).
What are the key properties of 4-[2-[4-methoxy-3,5-bis(trifluoromethyl)phenyl]phenyl]benzenesulfonamide?
4-[2-[4-methoxy-3,5-bis(trifluoromethyl)phenyl]phenyl]benzenesulfonamide has a molecular weight of 475.41 g/mol, XLogP of 5.71, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[4-methoxy-3,5-bis(trifluoromethyl)phenyl]phenyl]benzenesulfonamide is sourced from PubChem (CID 23451406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).