About 1-bromo-4,5-difluoro-2-(2-methylsulfonylphenyl)benzene
1-bromo-4,5-difluoro-2-(2-methylsulfonylphenyl)benzene (PubChem CID 23451412) has the molecular formula C13H9BrF2O2S
and a molecular weight of 347.18 g/mol. Its IUPAC name is 1-bromo-4,5-difluoro-2-(2-methylsulfonylphenyl)benzene.
Molecular Properties
| Compound Name | 1-bromo-4,5-difluoro-2-(2-methylsulfonylphenyl)benzene |
| PubChem CID | 23451412 |
| Molecular Formula | C13H9BrF2O2S |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 345.95 |
| IUPAC Name | 1-bromo-4,5-difluoro-2-(2-methylsulfonylphenyl)benzene |
| SMILES | CS(=O)(=O)c1ccccc1-c1cc(F)c(F)cc1Br |
| InChI | InChI=1S/C13H9BrF2O2S/c1-19(17,18)13-5-3-2-4-8(13)9-6-11(15)12(16)7-10(9)14/h2-7H,1H3 |
| InChIKey | NQNIAWGEVOWUDW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4,5-difluoro-2-(2-methylsulfonylphenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4,5-difluoro-2-(2-methylsulfonylphenyl)benzene?
The IUPAC name of 1-bromo-4,5-difluoro-2-(2-methylsulfonylphenyl)benzene (CID 23451412) is 1-bromo-4,5-difluoro-2-(2-methylsulfonylphenyl)benzene.
What is the SMILES notation for 1-bromo-4,5-difluoro-2-(2-methylsulfonylphenyl)benzene?
The canonical SMILES for 1-bromo-4,5-difluoro-2-(2-methylsulfonylphenyl)benzene is CS(=O)(=O)c1ccccc1-c1cc(F)c(F)cc1Br.
What is the InChIKey of 1-bromo-4,5-difluoro-2-(2-methylsulfonylphenyl)benzene?
The InChIKey is NQNIAWGEVOWUDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrF2O2S/c1-19(17,18)13-5-3-2-4-8(13)9-6-11(15)12(16)7-10(9)14/h2-7H,1H3.
What are the key properties of 1-bromo-4,5-difluoro-2-(2-methylsulfonylphenyl)benzene?
1-bromo-4,5-difluoro-2-(2-methylsulfonylphenyl)benzene has a molecular weight of 347.18 g/mol, XLogP of 3.80, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4,5-difluoro-2-(2-methylsulfonylphenyl)benzene is sourced from PubChem (CID 23451412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).