About 2-(2,2-dichloroethenyl)-3-[(E)-2-methoxyethenyl]-1,1-dimethylcyclopropane
2-(2,2-dichloroethenyl)-3-[(E)-2-methoxyethenyl]-1,1-dimethylcyclopropane (PubChem CID 23451683) has the molecular formula C10H14Cl2O
and a molecular weight of 221.13 g/mol. Its IUPAC name is 2-(2,2-dichloroethenyl)-3-[(E)-2-methoxyethenyl]-1,1-dimethylcyclopropane.
Molecular Properties
| Compound Name | 2-(2,2-dichloroethenyl)-3-[(E)-2-methoxyethenyl]-1,1-dimethylcyclopropane |
| PubChem CID | 23451683 |
| Molecular Formula | C10H14Cl2O |
| Molecular Weight | 221.13 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | 2-(2,2-dichloroethenyl)-3-[(E)-2-methoxyethenyl]-1,1-dimethylcyclopropane |
| SMILES | CO/C=C/C1C(C=C(Cl)Cl)C1(C)C |
| InChI | InChI=1S/C10H14Cl2O/c1-10(2)7(4-5-13-3)8(10)6-9(11)12/h4-8H,1-3H3/b5-4+ |
| InChIKey | KKIYNLKQAFPSMI-SNAWJCMRSA-N |
| XLogP | 3.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.13 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-dichloroethenyl)-3-[(E)-2-methoxyethenyl]-1,1-dimethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dichloroethenyl)-3-[(E)-2-methoxyethenyl]-1,1-dimethylcyclopropane?
The IUPAC name of 2-(2,2-dichloroethenyl)-3-[(E)-2-methoxyethenyl]-1,1-dimethylcyclopropane (CID 23451683) is 2-(2,2-dichloroethenyl)-3-[(E)-2-methoxyethenyl]-1,1-dimethylcyclopropane.
What is the SMILES notation for 2-(2,2-dichloroethenyl)-3-[(E)-2-methoxyethenyl]-1,1-dimethylcyclopropane?
The canonical SMILES for 2-(2,2-dichloroethenyl)-3-[(E)-2-methoxyethenyl]-1,1-dimethylcyclopropane is CO/C=C/C1C(C=C(Cl)Cl)C1(C)C.
What is the InChIKey of 2-(2,2-dichloroethenyl)-3-[(E)-2-methoxyethenyl]-1,1-dimethylcyclopropane?
The InChIKey is KKIYNLKQAFPSMI-SNAWJCMRSA-N. The full InChI is InChI=1S/C10H14Cl2O/c1-10(2)7(4-5-13-3)8(10)6-9(11)12/h4-8H,1-3H3/b5-4+.
What are the key properties of 2-(2,2-dichloroethenyl)-3-[(E)-2-methoxyethenyl]-1,1-dimethylcyclopropane?
2-(2,2-dichloroethenyl)-3-[(E)-2-methoxyethenyl]-1,1-dimethylcyclopropane has a molecular weight of 221.13 g/mol, XLogP of 3.74, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dichloroethenyl)-3-[(E)-2-methoxyethenyl]-1,1-dimethylcyclopropane is sourced from PubChem (CID 23451683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).